C19H15BrN8O3S — CID 135630418
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide (PubChem CID 135630418) has the molecular formula C19H15BrN8O3S and a molecular weight of 515.35 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 135630418 |
| Molecular Formula | C19H15BrN8O3S |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2cc(Br)ccc2O)c1CSc1ccccc1 |
| InChI | InChI=1S/C19H15BrN8O3S/c20-12-6-7-15(29)11(8-12)9-22-24-19(30)16-14(10-32-13-4-2-1-3-5-13)28(27-23-16)18-17(21)25-31-26-18/h1-9,29H,10H2,(H2,21,25)(H,24,30)/b22-9+ |
| InChIKey | HDNLYBACAHMNAZ-LSFURLLWSA-N |
| XLogP | 2.76 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|