C19H15BrN8O2S — CID 6879179
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-bromophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide (PubChem CID 6879179) has the molecular formula C19H15BrN8O2S and a molecular weight of 499.35 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-bromophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-bromophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6879179 |
| Molecular Formula | C19H15BrN8O2S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-bromophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2ccc(Br)cc2)c1CSc1ccccc1 |
| InChI | InChI=1S/C19H15BrN8O2S/c20-13-8-6-12(7-9-13)10-22-24-19(29)16-15(11-31-14-4-2-1-3-5-14)28(27-23-16)18-17(21)25-30-26-18/h1-10H,11H2,(H2,21,25)(H,24,29)/b22-10+ |
| InChIKey | DLNVUICGSDEHER-LSHDLFTRSA-N |
| XLogP | 3.05 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|