C23H18N8O2S — CID 2043514
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(naphthalen-1-ylmethylideneamino)-5-(phenylsulfanylmethyl)triazole-4-carboxamide (PubChem CID 2043514) has the molecular formula C23H18N8O2S and a molecular weight of 470.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(naphthalen-1-ylmethylideneamino)-5-(phenylsulfanylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(naphthalen-1-ylmethylideneamino)-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 2043514 |
| Molecular Formula | C23H18N8O2S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(naphthalen-1-ylmethylideneamino)-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2cccc3ccccc23)c1CSc1ccccc1 |
| InChI | InChI=1S/C23H18N8O2S/c24-21-22(29-33-28-21)31-19(14-34-17-10-2-1-3-11-17)20(26-30-31)23(32)27-25-13-16-9-6-8-15-7-4-5-12-18(15)16/h1-13H,14H2,(H2,24,28)(H,27,32) |
| InChIKey | PWZYDDSNBADJES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|