C23H26ClN9O2 — CID 45054114
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]triazole-4-carboxamide;hydrochloride (PubChem CID 45054114) has the molecular formula C23H26ClN9O2 and a molecular weight of 495.98 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45054114 |
| Molecular Formula | C23H26ClN9O2 |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]triazole-4-carboxamide;hydrochloride |
| SMILES | CC1CCCCN1Cc1c(C(=O)N/N=C\c2cccc3ccccc23)nnn1-c1nonc1N.Cl |
| InChI | InChI=1S/C23H25N9O2.ClH/c1-15-7-4-5-12-31(15)14-19-20(26-30-32(19)22-21(24)28-34-29-22)23(33)27-25-13-17-10-6-9-16-8-2-3-11-18(16)17;/h2-3,6,8-11,13,15H,4-5,7,12,14H2,1H3,(H2,24,28)(H,27,33);1H/b25-13-; |
| InChIKey | MXHPALCPFKXYDM-OOBILFIOSA-N |
| XLogP | 2.95 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|