C19H21Cl2N9O2 — CID 92969189
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-5-[[(2S)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide (PubChem CID 92969189) has the molecular formula C19H21Cl2N9O2 and a molecular weight of 478.34 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-5-[[(2S)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-5-[[(2S)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 92969189 |
| Molecular Formula | C19H21Cl2N9O2 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-5-[[(2S)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide |
| SMILES | C[C@H]1CCCCN1Cc1c(C(=O)N/N=C/c2cccc(Cl)c2Cl)nnn1-c1nonc1N |
| InChI | InChI=1S/C19H21Cl2N9O2/c1-11-5-2-3-8-29(11)10-14-16(24-28-30(14)18-17(22)26-32-27-18)19(31)25-23-9-12-6-4-7-13(20)15(12)21/h4,6-7,9,11H,2-3,5,8,10H2,1H3,(H2,22,26)(H,25,31)/b23-9+/t11-/m0/s1 |
| InChIKey | UVVQLYYZZNCZNH-LGPHULDDSA-N |
| XLogP | 2.68 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|