C25H27N9O6 — CID 6241881
[2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] furan-2-carboxylate (PubChem CID 6241881) has the molecular formula C25H27N9O6 and a molecular weight of 549.55 g/mol. Its IUPAC name is [2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 6241881 |
| Molecular Formula | C25H27N9O6 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | [2-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cccc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2CN2CCCCC2C)c1OC(=O)c1ccco1 |
| InChI | InChI=1S/C25H27N9O6/c1-15-7-3-4-11-33(15)14-17-20(28-32-34(17)23-22(26)30-40-31-23)24(35)29-27-13-16-8-5-9-18(37-2)21(16)39-25(36)19-10-6-12-38-19/h5-6,8-10,12-13,15H,3-4,7,11,14H2,1-2H3,(H2,26,30)(H,29,35)/b27-13- |
| InChIKey | NCKVSELNBMXOER-WKIKZPBSSA-N |
| XLogP | 2.19 |
| TPSA | 189.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|