C20H25N9O4 — CID 136897399
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 136897399) has the molecular formula C20H25N9O4 and a molecular weight of 455.48 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 136897399 |
| Molecular Formula | C20H25N9O4 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2CN2CCC(C)CC2)c1O |
| InChI | InChI=1S/C20H25N9O4/c1-12-6-8-28(9-7-12)11-14-16(23-27-29(14)19-18(21)25-33-26-19)20(31)24-22-10-13-4-3-5-15(32-2)17(13)30/h3-5,10,12,30H,6-9,11H2,1-2H3,(H2,21,25)(H,24,31)/b22-10- |
| InChIKey | LTEVSYQLWJQHAA-YVNNLAQVSA-N |
| XLogP | 0.94 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|