C26H27N11O8 — CID 3515744
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 3515744) has the molecular formula C26H27N11O8 and a molecular weight of 621.57 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 3515744 |
| Molecular Formula | C26H27N11O8 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCC(C)CC2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N11O8/c1-15-7-9-34(10-8-15)14-19-23(29-33-35(19)25-24(27)31-45-32-25)26(38)30-28-13-16-3-5-21(22(11-16)43-2)44-20-6-4-17(36(39)40)12-18(20)37(41)42/h3-6,11-13,15H,7-10,14H2,1-2H3,(H2,27,31)(H,30,38) |
| InChIKey | NIRQGEUXXKELRE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 245.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|