C21H26N10O5 — CID 4585317
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 4585317) has the molecular formula C21H26N10O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4585317 |
| Molecular Formula | C21H26N10O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-methoxy-3-nitrophenyl)ethylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | COc1ccc(C(C)=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCCCC2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N10O5/c1-12-6-4-5-9-29(12)11-16-18(24-28-30(16)20-19(22)26-36-27-20)21(32)25-23-13(2)14-7-8-17(35-3)15(10-14)31(33)34/h7-8,10,12H,4-6,9,11H2,1-3H3,(H2,22,26)(H,25,32) |
| InChIKey | QJGZNXXUNCRUQE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 192.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|