C23H23N9O4 — CID 5146894
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide (PubChem CID 5146894) has the molecular formula C23H23N9O4 and a molecular weight of 489.50 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 5146894 |
| Molecular Formula | C23H23N9O4 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide |
| SMILES | COc1cc(C(C)=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCc3ccccc32)ccc1O |
| InChI | InChI=1S/C23H23N9O4/c1-13(15-7-8-18(33)19(11-15)35-2)25-27-23(34)20-17(32(30-26-20)22-21(24)28-36-29-22)12-31-10-9-14-5-3-4-6-16(14)31/h3-8,11,33H,9-10,12H2,1-2H3,(H2,24,28)(H,27,34) |
| InChIKey | RRZLAIQOSORWGZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|