C24H25N9O4 — CID 4686032
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(2,5-dimethoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 4686032) has the molecular formula C24H25N9O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(2,5-dimethoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(2,5-dimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4686032 |
| Molecular Formula | C24H25N9O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(2,5-dimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(C=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C24H25N9O4/c1-35-17-9-10-20(36-2)16(12-17)13-26-28-24(34)21-19(33(31-27-21)23-22(25)29-37-30-23)14-32-11-5-7-15-6-3-4-8-18(15)32/h3-4,6,8-10,12-13H,5,7,11,14H2,1-2H3,(H2,25,29)(H,28,34) |
| InChIKey | DMSRZNFYUNKJPI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|