C20H18BrN9O2S — CID 3779749
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromothiophen-2-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 3779749) has the molecular formula C20H18BrN9O2S and a molecular weight of 528.40 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromothiophen-2-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromothiophen-2-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3779749 |
| Molecular Formula | C20H18BrN9O2S |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromothiophen-2-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2ccc(Br)s2)c1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C20H18BrN9O2S/c21-16-8-7-13(33-16)10-23-25-20(31)17-15(30(28-24-17)19-18(22)26-32-27-19)11-29-9-3-5-12-4-1-2-6-14(12)29/h1-2,4,6-8,10H,3,5,9,11H2,(H2,22,26)(H,25,31) |
| InChIKey | GVNBHSDKBWTNBQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|