C24H23N9O2 — CID 5017800
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2,3-dihydroinden-1-ylideneamino)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 5017800) has the molecular formula C24H23N9O2 and a molecular weight of 469.51 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2,3-dihydroinden-1-ylideneamino)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2,3-dihydroinden-1-ylideneamino)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 5017800 |
| Molecular Formula | C24H23N9O2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2,3-dihydroinden-1-ylideneamino)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=C2CCc3ccccc32)c1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C24H23N9O2/c25-22-23(30-35-29-22)33-20(14-32-13-5-8-16-7-2-4-10-19(16)32)21(27-31-33)24(34)28-26-18-12-11-15-6-1-3-9-17(15)18/h1-4,6-7,9-10H,5,8,11-14H2,(H2,25,29)(H,28,34) |
| InChIKey | LCDXQDRCHLYOSP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|