C22H20BrN9O3 — CID 3545006
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 3545006) has the molecular formula C22H20BrN9O3 and a molecular weight of 538.37 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3545006 |
| Molecular Formula | C22H20BrN9O3 |
| Molecular Weight | 538.37 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2cc(Br)ccc2O)c1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C22H20BrN9O3/c23-15-7-8-18(33)14(10-15)11-25-27-22(34)19-17(32(30-26-19)21-20(24)28-35-29-21)12-31-9-3-5-13-4-1-2-6-16(13)31/h1-2,4,6-8,10-11,33H,3,5,9,12H2,(H2,24,28)(H,27,34) |
| InChIKey | KZBYESXITGVHKO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|