C26H23N9O3 — CID 135678724
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]triazole-4-carboxamide (PubChem CID 135678724) has the molecular formula C26H23N9O3 and a molecular weight of 509.53 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 135678724 |
| Molecular Formula | C26H23N9O3 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2c(O)ccc3ccccc23)c1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C26H23N9O3/c27-24-25(32-38-31-24)35-21(15-34-13-5-8-17-7-2-4-10-20(17)34)23(29-33-35)26(37)30-28-14-19-18-9-3-1-6-16(18)11-12-22(19)36/h1-4,6-7,9-12,14,36H,5,8,13,15H2,(H2,27,31)(H,30,37)/b28-14+ |
| InChIKey | AYPZXEBTHXZDQQ-CCVNUDIWSA-N |
| XLogP | 2.81 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|