C21H20N8O5 — CID 135484323
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide (PubChem CID 135484323) has the molecular formula C21H20N8O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 135484323 |
| Molecular Formula | C21H20N8O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1cccc(-c2c(C(=O)N/N=C(\C)c3ccc(O)c(OC)c3)nnn2-c2nonc2N)c1 |
| InChI | InChI=1S/C21H20N8O5/c1-11(12-7-8-15(30)16(10-12)33-3)23-25-21(31)17-18(13-5-4-6-14(9-13)32-2)29(28-24-17)20-19(22)26-34-27-20/h4-10,30H,1-3H3,(H2,22,26)(H,25,31)/b23-11+ |
| InChIKey | QVFLGPRRMQMELO-FOKLQQMPSA-N |
| XLogP | 1.78 |
| TPSA | 175.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|