C24H26N8O5 — CID 3717927
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxy-3-methoxyphenyl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide (PubChem CID 3717927) has the molecular formula C24H26N8O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxy-3-methoxyphenyl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxy-3-methoxyphenyl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3717927 |
| Molecular Formula | C24H26N8O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(4-ethoxy-3-methoxyphenyl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2c(C(=O)NN=C(C)c3ccc(OCC)c(OC)c3)nnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C24H26N8O5/c1-5-35-17-10-7-15(8-11-17)21-20(27-31-32(21)23-22(25)29-37-30-23)24(33)28-26-14(3)16-9-12-18(36-6-2)19(13-16)34-4/h7-13H,5-6H2,1-4H3,(H2,25,29)(H,28,33) |
| InChIKey | SZMUDKHTFZLYCB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|