C19H17BrN8O3S — CID 6237030
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide (PubChem CID 6237030) has the molecular formula C19H17BrN8O3S and a molecular weight of 517.37 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6237030 |
| Molecular Formula | C19H17BrN8O3S |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-5-(4-ethoxyphenyl)triazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2c(C(=O)N/N=C(/C)c3ccc(Br)s3)nnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C19H17BrN8O3S/c1-3-30-12-6-4-11(5-7-12)16-15(23-27-28(16)18-17(21)25-31-26-18)19(29)24-22-10(2)13-8-9-14(20)32-13/h4-9H,3H2,1-2H3,(H2,21,25)(H,24,29)/b22-10- |
| InChIKey | NKGVKAUDDIEAFU-YVNNLAQVSA-N |
| XLogP | 3.28 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|