C23H24N8O4 — CID 6224301
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-phenoxypropan-2-ylideneamino]-5-(4-propoxyphenyl)triazole-4-carboxamide (PubChem CID 6224301) has the molecular formula C23H24N8O4 and a molecular weight of 476.50 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-phenoxypropan-2-ylideneamino]-5-(4-propoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-phenoxypropan-2-ylideneamino]-5-(4-propoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6224301 |
| Molecular Formula | C23H24N8O4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-phenoxypropan-2-ylideneamino]-5-(4-propoxyphenyl)triazole-4-carboxamide |
| SMILES | CCCOc1ccc(-c2c(C(=O)N/N=C(/C)COc3ccccc3)nnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C23H24N8O4/c1-3-13-33-18-11-9-16(10-12-18)20-19(26-30-31(20)22-21(24)28-35-29-22)23(32)27-25-15(2)14-34-17-7-5-4-6-8-17/h4-12H,3,13-14H2,1-2H3,(H2,24,28)(H,27,32)/b25-15- |
| InChIKey | NEWPZTZNGAJILM-MYYYXRDXSA-N |
| XLogP | 2.87 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|