C23H22N8O5 — CID 6161411
methyl 4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-propoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 6161411) has the molecular formula C23H22N8O5 and a molecular weight of 490.48 g/mol. Its IUPAC name is methyl 4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-propoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-propoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6161411 |
| Molecular Formula | C23H22N8O5 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | methyl 4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-propoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | CCCOc1ccc(-c2c(C(=O)N/N=C/c3ccc(C(=O)OC)cc3)nnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C23H22N8O5/c1-3-12-35-17-10-8-15(9-11-17)19-18(26-30-31(19)21-20(24)28-36-29-21)22(32)27-25-13-14-4-6-16(7-5-14)23(33)34-2/h4-11,13H,3,12H2,1-2H3,(H2,24,28)(H,27,32)/b25-13+ |
| InChIKey | DRNFHBKQWMIXOL-DHRITJCHSA-N |
| XLogP | 2.24 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|