C17H18N8O4 — CID 3847404
methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-propyltriazole-4-carbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 3847404) has the molecular formula C17H18N8O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-propyltriazole-4-carbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-propyltriazole-4-carbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3847404 |
| Molecular Formula | C17H18N8O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-propyltriazole-4-carbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | CCCc1c(C(=O)NN=Cc2ccc(C(=O)OC)cc2)nnn1-c1nonc1N |
| InChI | InChI=1S/C17H18N8O4/c1-3-4-12-13(20-24-25(12)15-14(18)22-29-23-15)16(26)21-19-9-10-5-7-11(8-6-10)17(27)28-2/h5-9H,3-4H2,1-2H3,(H2,18,22)(H,21,26) |
| InChIKey | VUGGDONFWFLGQL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 163.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|