C22H20N8O5 — CID 3711225
methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 3711225) has the molecular formula C22H20N8O5 and a molecular weight of 476.45 g/mol. Its IUPAC name is methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3711225 |
| Molecular Formula | C22H20N8O5 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | CCOc1cccc(-c2c(C(=O)NN=Cc3ccc(C(=O)OC)cc3)nnn2-c2nonc2N)c1 |
| InChI | InChI=1S/C22H20N8O5/c1-3-34-16-6-4-5-15(11-16)18-17(25-29-30(18)20-19(23)27-35-28-20)21(31)26-24-12-13-7-9-14(10-8-13)22(32)33-2/h4-12H,3H2,1-2H3,(H2,23,27)(H,26,31) |
| InChIKey | PKOGGTBVYVUYLS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|