C21H20N8O6 — CID 136846371
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide (PubChem CID 136846371) has the molecular formula C21H20N8O6 and a molecular weight of 480.44 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 136846371 |
| Molecular Formula | C21H20N8O6 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(3-methoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1cccc(-c2c(C(=O)N/N=C\c3cc(OC)c(O)c(OC)c3)nnn2-c2nonc2N)c1 |
| InChI | InChI=1S/C21H20N8O6/c1-32-13-6-4-5-12(9-13)17-16(24-28-29(17)20-19(22)26-35-27-20)21(31)25-23-10-11-7-14(33-2)18(30)15(8-11)34-3/h4-10,30H,1-3H3,(H2,22,26)(H,25,31)/b23-10- |
| InChIKey | JRQHLNUWIIYREO-RMORIDSASA-N |
| XLogP | 1.39 |
| TPSA | 185.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|