C20H17N9O7 — CID 135580226
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide (PubChem CID 135580226) has the molecular formula C20H17N9O7 and a molecular weight of 495.41 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 135580226 |
| Molecular Formula | C20H17N9O7 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2nnn(-c3nonc3N)c2-c2ccc([N+](=O)[O-])cc2)cc(OC)c1O |
| InChI | InChI=1S/C20H17N9O7/c1-34-13-7-10(8-14(35-2)17(13)30)9-22-24-20(31)15-16(11-3-5-12(6-4-11)29(32)33)28(27-23-15)19-18(21)25-36-26-19/h3-9,30H,1-2H3,(H2,21,25)(H,24,31)/b22-9+ |
| InChIKey | QGLAKOQRXSYKNI-LSFURLLWSA-N |
| XLogP | 1.29 |
| TPSA | 218.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|