C25H20N10O5S — CID 46495351
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide (PubChem CID 46495351) has the molecular formula C25H20N10O5S and a molecular weight of 572.57 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 46495351 |
| Molecular Formula | C25H20N10O5S |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nnn(-c3nonc3N)c2-c2ccc([N+](=O)[O-])cc2)cc1CSc1ccccn1 |
| InChI | InChI=1S/C25H20N10O5S/c1-39-19-10-5-15(12-17(19)14-41-20-4-2-3-11-27-20)13-28-30-25(36)21-22(16-6-8-18(9-7-16)35(37)38)34(33-29-21)24-23(26)31-40-32-24/h2-13H,14H2,1H3,(H2,26,31)(H,30,36)/b28-13+ |
| InChIKey | IVYCJMMWMMEMSP-XODNFHPESA-N |
| XLogP | 3.27 |
| TPSA | 202.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|