C26H20ClN9O6 — CID 6059213
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 6059213) has the molecular formula C26H20ClN9O6 and a molecular weight of 589.96 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6059213 |
| Molecular Formula | C26H20ClN9O6 |
| Molecular Weight | 589.96 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2-c2cccc([N+](=O)[O-])c2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClN9O6/c1-40-21-11-16(7-10-20(21)41-14-15-5-8-18(27)9-6-15)13-29-31-26(37)22-23(17-3-2-4-19(12-17)36(38)39)35(34-30-22)25-24(28)32-42-33-25/h2-13H,14H2,1H3,(H2,28,32)(H,31,37)/b29-13- |
| InChIKey | KHDLRJYHNUDXOZ-DBFSUHOCSA-N |
| XLogP | 3.81 |
| TPSA | 198.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|