C23H22N8O6 — CID 6888528
[4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 6888528) has the molecular formula C23H22N8O6 and a molecular weight of 506.48 g/mol. Its IUPAC name is [4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 6888528 |
| Molecular Formula | C23H22N8O6 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-ethoxyphenyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | CCOc1ccc(-c2c(C(=O)N/N=C/c3ccc(OC(C)=O)c(OC)c3)nnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C23H22N8O6/c1-4-35-16-8-6-15(7-9-16)20-19(26-30-31(20)22-21(24)28-37-29-22)23(33)27-25-12-14-5-10-17(36-13(2)32)18(11-14)34-3/h5-12H,4H2,1-3H3,(H2,24,28)(H,27,33)/b25-12+ |
| InChIKey | KJEIEIULZQJWDX-BRJLIKDPSA-N |
| XLogP | 2.00 |
| TPSA | 181.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|