C20H16N8O6 — CID 6891733
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 6891733) has the molecular formula C20H16N8O6 and a molecular weight of 464.40 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6891733 |
| Molecular Formula | C20H16N8O6 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nnn(-c3nonc3N)c2-c2ccc3c(c2)OCO3)cc1O |
| InChI | InChI=1S/C20H16N8O6/c1-31-13-4-2-10(6-12(13)29)8-22-24-20(30)16-17(11-3-5-14-15(7-11)33-9-32-14)28(27-23-16)19-18(21)25-34-26-19/h2-8,29H,9H2,1H3,(H2,21,25)(H,24,30)/b22-8+ |
| InChIKey | OLAYWOBOPBDDNO-GZIVZEMBSA-N |
| XLogP | 1.11 |
| TPSA | 185.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|