C18H14N8O4 — CID 135650773
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 135650773) has the molecular formula C18H14N8O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 135650773 |
| Molecular Formula | C18H14N8O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2ccc(O)c(O)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H14N8O4/c19-16-17(24-30-23-16)26-15(11-4-2-1-3-5-11)14(21-25-26)18(29)22-20-9-10-6-7-12(27)13(28)8-10/h1-9,27-28H,(H2,19,23)(H,22,29)/b20-9+ |
| InChIKey | JJTAZISVPWFWHO-AWQFTUOYSA-N |
| XLogP | 1.07 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|