C18H12BrFN8O2 — CID 5007724
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromo-2-fluorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 5007724) has the molecular formula C18H12BrFN8O2 and a molecular weight of 471.25 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromo-2-fluorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromo-2-fluorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 5007724 |
| Molecular Formula | C18H12BrFN8O2 |
| Molecular Weight | 471.25 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromo-2-fluorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2ccc(Br)cc2F)c1-c1ccccc1 |
| InChI | InChI=1S/C18H12BrFN8O2/c19-12-7-6-11(13(20)8-12)9-22-24-18(29)14-15(10-4-2-1-3-5-10)28(27-23-14)17-16(21)25-30-26-17/h1-9H,(H2,21,25)(H,24,29) |
| InChIKey | VQOIBZFHHBWNSS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|