C14H13FN8O2 — CID 126457037
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(E)-(2-fluorophenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 126457037) has the molecular formula C14H13FN8O2 and a molecular weight of 344.31 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(E)-(2-fluorophenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(E)-(2-fluorophenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 126457037 |
| Molecular Formula | C14H13FN8O2 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(E)-(2-fluorophenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | CCc1c(C(=O)N/N=C/c2ccccc2F)nnn1-c1nonc1N |
| InChI | InChI=1S/C14H13FN8O2/c1-2-10-11(18-22-23(10)13-12(16)20-25-21-13)14(24)19-17-7-8-5-3-4-6-9(8)15/h3-7H,2H2,1H3,(H2,16,20)(H,19,24)/b17-7+ |
| InChIKey | FOTNASTXISBCDD-REZTVBANSA-N |
| XLogP | 0.70 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|