C15H15FN8O2 — CID 6891340
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-5-propyltriazole-4-carboxamide (PubChem CID 6891340) has the molecular formula C15H15FN8O2 and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-5-propyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-5-propyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 6891340 |
| Molecular Formula | C15H15FN8O2 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-5-propyltriazole-4-carboxamide |
| SMILES | CCCc1c(C(=O)N/N=C/c2ccc(F)cc2)nnn1-c1nonc1N |
| InChI | InChI=1S/C15H15FN8O2/c1-2-3-11-12(19-23-24(11)14-13(17)21-26-22-14)15(25)20-18-8-9-4-6-10(16)7-5-9/h4-8H,2-3H2,1H3,(H2,17,21)(H,20,25)/b18-8+ |
| InChIKey | SCYOHRNGZMZYQH-QGMBQPNBSA-N |
| XLogP | 1.09 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|