C17H21N9O4 — CID 6889018
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide (PubChem CID 6889018) has the molecular formula C17H21N9O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6889018 |
| Molecular Formula | C17H21N9O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2nnn(-c3nonc3N)c2CN(C)C)c1OC |
| InChI | InChI=1S/C17H21N9O4/c1-25(2)9-11-13(20-24-26(11)16-15(18)22-30-23-16)17(27)21-19-8-10-6-5-7-12(28-3)14(10)29-4/h5-8H,9H2,1-4H3,(H2,18,22)(H,21,27)/b19-8+ |
| InChIKey | DKZDIUZIXROLHI-UFWORHAWSA-N |
| XLogP | 0.08 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|