C18H23N9O5 — CID 2024271
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 2024271) has the molecular formula C18H23N9O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 2024271 |
| Molecular Formula | C18H23N9O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | COc1cc(OC)c(C=NNC(=O)c2nnn(-c3nonc3N)c2CN(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H23N9O5/c1-26(2)9-12-15(21-25-27(12)17-16(19)23-32-24-17)18(28)22-20-8-11-13(30-4)6-10(29-3)7-14(11)31-5/h6-8H,9H2,1-5H3,(H2,19,23)(H,22,28) |
| InChIKey | XXPMBSNZVVNQDX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|