C15H15Br2N9O3 — CID 135538884
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide (PubChem CID 135538884) has the molecular formula C15H15Br2N9O3 and a molecular weight of 529.15 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 135538884 |
| Molecular Formula | C15H15Br2N9O3 |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 526.97 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide |
| SMILES | CN(C)Cc1c(C(=O)N/N=C/c2cc(Br)c(O)c(Br)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C15H15Br2N9O3/c1-25(2)6-10-11(20-24-26(10)14-13(18)22-29-23-14)15(28)21-19-5-7-3-8(16)12(27)9(17)4-7/h3-5,27H,6H2,1-2H3,(H2,18,22)(H,21,28)/b19-5+ |
| InChIKey | LWYILZIXVOHCCV-PTXOJBNSSA-N |
| XLogP | 1.29 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|