C16H18N8O5 — CID 6110669
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5-(methoxymethyl)triazole-4-carboxamide (PubChem CID 6110669) has the molecular formula C16H18N8O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5-(methoxymethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5-(methoxymethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6110669 |
| Molecular Formula | C16H18N8O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-5-(methoxymethyl)triazole-4-carboxamide |
| SMILES | COCc1c(C(=O)N/N=C\c2cccc(OC)c2OC)nnn1-c1nonc1N |
| InChI | InChI=1S/C16H18N8O5/c1-26-8-10-12(19-23-24(10)15-14(17)21-29-22-15)16(25)20-18-7-9-5-4-6-11(27-2)13(9)28-3/h4-7H,8H2,1-3H3,(H2,17,21)(H,20,25)/b18-7- |
| InChIKey | STZCWTBFUUFZEG-WSVATBPTSA-N |
| XLogP | 0.16 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|