C19H23N9O5 — CID 3677150
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dimethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide (PubChem CID 3677150) has the molecular formula C19H23N9O5 and a molecular weight of 457.45 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dimethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dimethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3677150 |
| Molecular Formula | C19H23N9O5 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dimethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
| SMILES | COc1cccc(C=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCOCC2)c1OC |
| InChI | InChI=1S/C19H23N9O5/c1-30-14-5-3-4-12(16(14)31-2)10-21-23-19(29)15-13(11-27-6-8-32-9-7-27)28(26-22-15)18-17(20)24-33-25-18/h3-5,10H,6-9,11H2,1-2H3,(H2,20,24)(H,23,29) |
| InChIKey | ACTGXXVLGWCHKY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|