C19H23N9O4 — CID 44726945
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide (PubChem CID 44726945) has the molecular formula C19H23N9O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 44726945 |
| Molecular Formula | C19H23N9O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
| SMILES | CCOc1ccccc1/C=N/NC(=O)c1c(CN2CCOCC2)nnn1-c1nonc1N |
| InChI | InChI=1S/C19H23N9O4/c1-2-31-15-6-4-3-5-13(15)11-21-23-19(29)16-14(12-27-7-9-30-10-8-27)22-26-28(16)18-17(20)24-32-25-18/h3-6,11H,2,7-10,12H2,1H3,(H2,20,24)(H,23,29)/b21-11+ |
| InChIKey | CGWUDVNJPOZKSL-SRZZPIQSSA-N |
| XLogP | 0.23 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|