C17H26ClN9O3 — CID 45053952
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-cyclohexylmethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide;hydrochloride (PubChem CID 45053952) has the molecular formula C17H26ClN9O3 and a molecular weight of 439.91 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-cyclohexylmethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-cyclohexylmethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45053952 |
| Molecular Formula | C17H26ClN9O3 |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-cyclohexylmethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.Nc1nonc1-n1nnc(CN2CCOCC2)c1C(=O)N/N=C/C1CCCCC1 |
| InChI | InChI=1S/C17H25N9O3.ClH/c18-15-16(23-29-22-15)26-14(13(20-24-26)11-25-6-8-28-9-7-25)17(27)21-19-10-12-4-2-1-3-5-12;/h10,12H,1-9,11H2,(H2,18,22)(H,21,27);1H/b19-10+; |
| InChIKey | WSJZUNAVUOIPIN-ZIOFAICLSA-N |
| XLogP | 0.78 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|