C28H27N9O4 — CID 45053956
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide (PubChem CID 45053956) has the molecular formula C28H27N9O4 and a molecular weight of 553.58 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 45053956 |
| Molecular Formula | C28H27N9O4 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(CN2CCOCC2)c1C(=O)N/N=C/c1ccccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H27N9O4/c29-26-27(34-41-33-26)37-25(23(31-35-37)17-36-12-14-39-15-13-36)28(38)32-30-16-20-7-2-4-11-24(20)40-18-21-9-5-8-19-6-1-3-10-22(19)21/h1-11,16H,12-15,17-18H2,(H2,29,33)(H,32,38)/b30-16+ |
| InChIKey | DEAFUXHLQLOKJV-OKCVXOCRSA-N |
| XLogP | 2.56 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|