C25H24BrN9O4 — CID 45053988
[2-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-5-bromophenyl] benzoate (PubChem CID 45053988) has the molecular formula C25H24BrN9O4 and a molecular weight of 594.43 g/mol. Its IUPAC name is [2-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-5-bromophenyl] benzoate.
| Compound Name | [2-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-5-bromophenyl] benzoate |
|---|---|
| PubChem CID | 45053988 |
| Molecular Formula | C25H24BrN9O4 |
| Molecular Weight | 594.43 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | [2-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-5-bromophenyl] benzoate |
| SMILES | Nc1nonc1-n1nnc(CN2CCCCC2)c1C(=O)N/N=C/c1ccc(Br)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24BrN9O4/c26-18-10-9-17(20(13-18)38-25(37)16-7-3-1-4-8-16)14-28-30-24(36)21-19(15-34-11-5-2-6-12-34)29-33-35(21)23-22(27)31-39-32-23/h1,3-4,7-10,13-14H,2,5-6,11-12,15H2,(H2,27,31)(H,30,36)/b28-14+ |
| InChIKey | DMECFCLWVREWII-CCVNUDIWSA-N |
| XLogP | 2.96 |
| TPSA | 166.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|