C17H18BrN9O2 — CID 44726546
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-bromophenyl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 44726546) has the molecular formula C17H18BrN9O2 and a molecular weight of 460.30 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-bromophenyl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-bromophenyl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 44726546 |
| Molecular Formula | C17H18BrN9O2 |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-bromophenyl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(CN2CCCC2)c1C(=O)N/N=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C17H18BrN9O2/c18-12-5-3-4-11(8-12)9-20-22-17(28)14-13(10-26-6-1-2-7-26)21-25-27(14)16-15(19)23-29-24-16/h3-5,8-9H,1-2,6-7,10H2,(H2,19,23)(H,22,28)/b20-9+ |
| InChIKey | LDFIRQJMCRSTDD-AWQFTUOYSA-N |
| XLogP | 1.35 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|