C15H16N10O5 — CID 3452894
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 3452894) has the molecular formula C15H16N10O5 and a molecular weight of 416.36 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3452894 |
| Molecular Formula | C15H16N10O5 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-nitrofuran-2-yl)methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(CN2CCCC2)c1C(=O)NN=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H16N10O5/c16-13-14(21-30-20-13)24-12(10(18-22-24)8-23-5-1-2-6-23)15(26)19-17-7-9-3-4-11(29-9)25(27)28/h3-4,7H,1-2,5-6,8H2,(H2,16,20)(H,19,26) |
| InChIKey | ZWKOERBPFZBUDD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 196.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|