C18H21N9O3 — CID 136722921
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 136722921) has the molecular formula C18H21N9O3 and a molecular weight of 411.43 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 136722921 |
| Molecular Formula | C18H21N9O3 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1c(CN2CCCC2)nnn1-c1nonc1N)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H21N9O3/c1-11(12-4-6-13(28)7-5-12)20-22-18(29)15-14(10-26-8-2-3-9-26)21-25-27(15)17-16(19)23-30-24-17/h4-7,28H,2-3,8-10H2,1H3,(H2,19,23)(H,22,29)/b20-11- |
| InChIKey | RULOYTMCGNIHOI-JAIQZWGSSA-N |
| XLogP | 0.69 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|