C18H24ClN9O3 — CID 45053896
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]triazole-4-carboxamide;hydrochloride (PubChem CID 45053896) has the molecular formula C18H24ClN9O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]triazole-4-carboxamide;hydrochloride.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45053896 |
| Molecular Formula | C18H24ClN9O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]triazole-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)Cc1nnn(-c2nonc2N)c1C(=O)N/N=C(\C)c1cccc(O)c1.Cl |
| InChI | InChI=1S/C18H23N9O3.ClH/c1-4-26(5-2)10-14-15(27(25-21-14)17-16(19)23-30-24-17)18(29)22-20-11(3)12-7-6-8-13(28)9-12;/h6-9,28H,4-5,10H2,1-3H3,(H2,19,23)(H,22,29);1H/b20-11+; |
| InChIKey | CSTDBXZOPTWTRQ-DOELHFPHSA-N |
| XLogP | 1.36 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|