C15H19N9O2S — CID 44726153
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide (PubChem CID 44726153) has the molecular formula C15H19N9O2S and a molecular weight of 389.45 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 44726153 |
| Molecular Formula | C15H19N9O2S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide |
| SMILES | CCN(CC)Cc1nnn(-c2nonc2N)c1C(=O)N/N=C/c1cccs1 |
| InChI | InChI=1S/C15H19N9O2S/c1-3-23(4-2)9-11-12(15(25)19-17-8-10-6-5-7-27-10)24(22-18-11)14-13(16)20-26-21-14/h5-8H,3-4,9H2,1-2H3,(H2,16,20)(H,19,25)/b17-8+ |
| InChIKey | WIHKNDUPBIVVSS-CAOOACKPSA-N |
| XLogP | 0.90 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|