C18H21N11O2 — CID 4989825
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-(diethylaminomethyl)triazole-4-carboxamide (PubChem CID 4989825) has the molecular formula C18H21N11O2 and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-(diethylaminomethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-(diethylaminomethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 4989825 |
| Molecular Formula | C18H21N11O2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-(diethylaminomethyl)triazole-4-carboxamide |
| SMILES | CCN(CC)Cc1c(C(=O)NN=Cc2nc3ccccc3[nH]2)nnn1-c1nonc1N |
| InChI | InChI=1S/C18H21N11O2/c1-3-28(4-2)10-13-15(23-27-29(13)17-16(19)25-31-26-17)18(30)24-20-9-14-21-11-7-5-6-8-12(11)22-14/h5-9H,3-4,10H2,1-2H3,(H2,19,25)(H,21,22)(H,24,30) |
| InChIKey | MLDJGMBHNQUAPN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 169.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|