C14H12N10O2 — CID 3772819
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-methyltriazole-4-carboxamide (PubChem CID 3772819) has the molecular formula C14H12N10O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3772819 |
| Molecular Formula | C14H12N10O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(1H-benzimidazol-2-ylmethylideneamino)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NN=Cc2nc3ccccc3[nH]2)nnn1-c1nonc1N |
| InChI | InChI=1S/C14H12N10O2/c1-7-11(19-23-24(7)13-12(15)21-26-22-13)14(25)20-16-6-10-17-8-4-2-3-5-9(8)18-10/h2-6H,1H3,(H2,15,21)(H,17,18)(H,20,25) |
| InChIKey | FPYPNZNHQZRGHF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 165.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|