C15H15N9O4 — CID 3514609
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 3514609) has the molecular formula C15H15N9O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3514609 |
| Molecular Formula | C15H15N9O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NN=Cc2ccc(OCC(N)=O)cc2)nnn1-c1nonc1N |
| InChI | InChI=1S/C15H15N9O4/c1-8-12(19-23-24(8)14-13(17)21-28-22-14)15(26)20-18-6-9-2-4-10(5-3-9)27-7-11(16)25/h2-6H,7H2,1H3,(H2,16,25)(H2,17,21)(H,20,26) |
| InChIKey | SLTIFHUOKCEBGZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 189.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|