C23H23N9O6 — CID 3394767
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide (PubChem CID 3394767) has the molecular formula C23H23N9O6 and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3394767 |
| Molecular Formula | C23H23N9O6 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-(2-amino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-5-(phenoxymethyl)triazole-4-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2nnn(-c3nonc3N)c2COc2ccccc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H23N9O6/c1-2-35-18-10-14(8-9-17(18)37-13-19(24)33)11-26-28-23(34)20-16(12-36-15-6-4-3-5-7-15)32(31-27-20)22-21(25)29-38-30-22/h3-11H,2,12-13H2,1H3,(H2,24,33)(H2,25,29)(H,28,34) |
| InChIKey | QPFCRRWXBQKJEH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 207.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|